What is the molecular formula of 2-Bromo-6-fluorotoluene?
The molecular formula is C7H6BrF.
What is the molecular weight of 2-Bromo-6-fluorotoluene?
The molecular weight is 189.02 g/mol.
What is the IUPAC name of 2-Bromo-6-fluorotoluene?
The IUPAC name is 1-bromo-3-fluoro-2-methylbenzene.
What is the InChI of 2-Bromo-6-fluorotoluene?
The InChI is InChI=1S/C7H6BrF/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3.
What is the InChIKey of 2-Bromo-6-fluorotoluene?
The InChIKey is DJGXPFQIMLEVPA-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-6-fluorotoluene?
The canonical SMILES is CC1=C(C=CC=C1Br)F.
What is the CAS number of 2-Bromo-6-fluorotoluene?
The CAS number is 1422-54-4.
What is the European Community (EC) number of 2-Bromo-6-fluorotoluene?
The EC number is 642-646-1.
What is the DSSTox Substance ID of 2-Bromo-6-fluorotoluene?
The DSSTox Substance ID is DTXSID80371285.
Is 2-Bromo-6-fluorotoluene a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.