What is the molecular formula of Naphthol AS-D?
The molecular formula of Naphthol AS-D is C18H15NO2.
What is the molecular weight of Naphthol AS-D?
The molecular weight of Naphthol AS-D is 277.3 g/mol.
What is the IUPAC name of Naphthol AS-D?
The IUPAC name of Naphthol AS-D is 3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide.
What is the InChI of Naphthol AS-D?
The InChI of Naphthol AS-D is InChI=1S/C18H15NO2/c1-12-6-2-5-9-16(12)19-18(21)15-10-13-7-3-4-8-14(13)11-17(15)20/h2-11,20H,1H3,(H,19,21).
What is the InChIKey of Naphthol AS-D?
The InChIKey of Naphthol AS-D is FBLAHUMENIHUGG-UHFFFAOYSA-N.
What is the canonical SMILES of Naphthol AS-D?
The canonical SMILES of Naphthol AS-D is CC1=CC=CC=C1NC(=O)C2=CC3=CC=CC=C3C=C2O.
What is the CAS number of Naphthol AS-D?
The CAS number of Naphthol AS-D is 135-61-5.
What is the XLogP3-AA value of Naphthol AS-D?
The XLogP3-AA value of Naphthol AS-D is 4.6.
How many hydrogen bond donor counts does Naphthol AS-D have?
Naphthol AS-D has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Naphthol AS-D have?
Naphthol AS-D has 2 hydrogen bond acceptor counts.
What is the hydrogen bond donor count of Naphthol AS-D?
The hydrogen bond donor count of Naphthol AS-D is 2.
What is the hydrogen bond acceptor count of Naphthol AS-D?
The hydrogen bond acceptor count of Naphthol AS-D is 2.
How many rotatable bonds does Naphthol AS-D have?
Naphthol AS-D has 2 rotatable bonds.