What is the PubChem CID of 5-Bromobenzothiophene?
The PubChem CID of 5-Bromobenzothiophene is 2776578.
What is the molecular formula of 5-Bromobenzothiophene?
The molecular formula of 5-Bromobenzothiophene is C8H5BrS.
What is the molecular weight of 5-Bromobenzothiophene?
The molecular weight of 5-Bromobenzothiophene is 213.10 g/mol.
What is the IUPAC name of 5-Bromobenzothiophene?
The IUPAC name of 5-Bromobenzothiophene is 5-bromo-1-benzothiophene.
What is the InChI of 5-Bromobenzothiophene?
The InChI of 5-Bromobenzothiophene is InChI=1S/C8H5BrS/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H.
What is the InChIKey of 5-Bromobenzothiophene?
The InChIKey of 5-Bromobenzothiophene is RDSIMGKJEYNNLF-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromobenzothiophene?
The canonical SMILES of 5-Bromobenzothiophene is C1=CC2=C(C=CS2)C=C1Br.
What is the CAS number of 5-Bromobenzothiophene?
The CAS number of 5-Bromobenzothiophene is 4923-87-9.
What is the XLogP3 value of 5-Bromobenzothiophene?
The XLogP3 value of 5-Bromobenzothiophene is 3.8.
Is 5-Bromobenzothiophene a canonicalized compound according to PubChem?
Yes, 5-Bromobenzothiophene is a canonicalized compound according to PubChem.