What is the PubChem CID of Disperse Orange 76?
The PubChem CID of Disperse Orange 76 is 83322.
What is the molecular formula of Disperse Orange 76?
The molecular formula of Disperse Orange 76 is C17H15Cl2N5O2.
What is the molecular weight of Disperse Orange 76?
The molecular weight of Disperse Orange 76 is 392.2 g/mol.
What are the synonyms of Disperse Orange 76?
The synonyms of Disperse Orange 76 are Disperse Orange 37 and C.I. Disperse Orange 37.
What is the IUPAC Name of Disperse Orange 76?
The IUPAC Name of Disperse Orange 76 is 3-[4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-ethylanilino]propanenitrile.
What is the InChIKey of Disperse Orange 76?
The InChIKey of Disperse Orange 76 is KHZRTXVUEZJYNE-UHFFFAOYSA-N.
What is the Canonical SMILES of Disperse Orange 76?
The Canonical SMILES of Disperse Orange 76 is CCN(CCC#N)C1=CC=C(C=C1)N=NC2=C(C=C(C=C2Cl)[N+](=O)[O-])Cl.
What is the CAS number of Disperse Orange 76?
The CAS number of Disperse Orange 76 is 13301-61-6.
What is the XLogP3-AA value of Disperse Orange 76?
The XLogP3-AA value of Disperse Orange 76 is 5.
What is the Topological Polar Surface Area of Disperse Orange 76?
The Topological Polar Surface Area of Disperse Orange 76 is 97.6 ?2.