The molecular weight of tolterodine is 325.5 g/mol.
What is the IUPAC name of tolterodine?
The IUPAC name of tolterodine is 2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-methylphenol.
What is the InChI of tolterodine?
The InChI of tolterodine is InChI=1S/C22H31NO/c1-16(2)23(17(3)4)14-13-20(19-9-7-6-8-10-19)21-15-18(5)11-12-22(21)24/h6-12,15-17,20,24H,13-14H2,1-5H3/t20-/m1/s1.
What is the InChIKey of tolterodine?
The InChIKey of tolterodine is OOGJQPCLVADCPB-HXUWFJFHSA-N.
What is the canonical SMILES of tolterodine?
The canonical SMILES of tolterodine is CC1=CC(=C(C=C1)O)C(CCN(C(C)C)C(C)C)C2=CC=CC=C2.
What is the CAS number of tolterodine?
The CAS number of tolterodine is 124937-51-5.
What is the ChEMBL ID of tolterodine?
The ChEMBL ID of tolterodine is CHEMBL1382.
What is the XLogP3-AA value of tolterodine?
The XLogP3-AA value of tolterodine is 5.6.
How many rotatable bonds does tolterodine have?
Tolterodine has 7 rotatable bonds.
※ Please kindly note that our products are for research use only.