What is the molecular formula of 2-N-Propyl Pramipexole?
The molecular formula of 2-N-Propyl Pramipexole is C13H23N3S.
What are the synonyms for 2-N-Propyl Pramipexole?
The synonyms for 2-N-Propyl Pramipexole are N-Propylpramipexole and HFX3W8MNCL.
What is the molecular weight of 2-N-Propyl Pramipexole?
The molecular weight of 2-N-Propyl Pramipexole is 253.41 g/mol.
When was 2-N-Propyl Pramipexole created?
2-N-Propyl Pramipexole was created on February 23, 2012.
When was 2-N-Propyl Pramipexole last modified?
2-N-Propyl Pramipexole was last modified on October 21, 2023.
What is the IUPAC name of 2-N-Propyl Pramipexole?
The IUPAC name of 2-N-Propyl Pramipexole is (6S)-2-N,6-N-dipropyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine.
What is the InChI of 2-N-Propyl Pramipexole?
The InChI of 2-N-Propyl Pramipexole is InChI=1S/C13H23N3S/c1-3-7-14-10-5-6-11-12(9-10)17-13(16-11)15-8-4-2/h10,14H,3-9H2,1-2H3,(H,15,16)/t10-/m0/s1.
What is the InChIKey of 2-N-Propyl Pramipexole?
The InChIKey of 2-N-Propyl Pramipexole is NSHVRDSQVRQBFT-JTQLQIEISA-N.
What are the other identifiers for 2-N-Propyl Pramipexole?
The other identifiers for 2-N-Propyl Pramipexole are CAS: 1246815-83-7, UNII: HFX3W8MNCL, DSSTox Substance ID: DTXSID80154459, Nikkaji Number: J3.430.625G, and Wikidata: Q27279909.
What is the XLogP3-AA value of 2-N-Propyl Pramipexole?
The XLogP3-AA value of 2-N-Propyl Pramipexole is 3.4.