What is the molecular formula of 6-Methoxy-2-pyridinylboronic acid MIDA ester?
The molecular formula is C11H13BN2O5.
What are the synonyms of 6-Methoxy-2-pyridinylboronic acid MIDA ester?
The synonyms are 1227700-45-9, 2-(6-Methoxypyridin-2-yl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 6-Methoxypyridine-2-boronic acid MIDA ester, Boron, [N-[(carboxy-kappaO)methyl]-N-methylglycinato(2-)-kappaN,kappaO](6-methoxy-2-pyridinyl)-, (T-4)-, 6-Methoxy-2-pyridinylboronic acid MIDA ester.
What is the molecular weight of 6-Methoxy-2-pyridinylboronic acid MIDA ester?
The molecular weight is 264.04 g/mol.
What is the IUPAC name of 6-Methoxy-2-pyridinylboronic acid MIDA ester?
The IUPAC name is 2-(6-methoxypyridin-2-yl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione.
What is the InChI of 6-Methoxy-2-pyridinylboronic acid MIDA ester?
The InChI is InChI=1S/C11H13BN2O5/c1-14-6-10(15)18-12(19-11(16)7-14)8-4-3-5-9(13-8)17-2/h3-5H,6-7H2,1-2H3.
What is the InChIKey of 6-Methoxy-2-pyridinylboronic acid MIDA ester?
The InChIKey is WBXOGDARCSEVBF-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Methoxy-2-pyridinylboronic acid MIDA ester?
The canonical SMILES is B1(OC(=O)CN(CC(=O)O1)C)C2=NC(=CC=C2)OC.
What is the CAS number of 6-Methoxy-2-pyridinylboronic acid MIDA ester?
The CAS number is 1227700-45-9.
What is the Nikkaji Number of 6-Methoxy-2-pyridinylboronic acid MIDA ester?
The Nikkaji Number is J2.848.066K.
※ Please kindly note that our products are for research use only.