What is the PubChem CID of Disperse Blue BGL?
PubChem CID: 83683
What is the molecular formula of Disperse Blue BGL?
Molecular Formula: C20H14N2O5
What is the molecular weight of Disperse Blue BGL?
Molecular Weight: 362.3 g/mol
What is the IUPAC name of Disperse Blue BGL?
IUPAC Name: 1,5-diamino-4,8-dihydroxy-2-(4-hydroxyphenyl)anthracene-9,10-dione
What is the InChI of Disperse Blue BGL?
InChI: InChI=1S/C20H14N2O5/c21-11-5-6-12(24)15-14(11)19(26)16-13(25)7-10(18(22)17(16)20(15)27)8-1-3-9(23)4-2-8/h1-7,23-25H,21-22H2
What is the InChIKey of Disperse Blue BGL?
InChIKey: OXLITIGRBOEDEZ-UHFFFAOYSA-N
What is the canonical SMILES of Disperse Blue BGL?
Canonical SMILES: C1=CC(=CC=C1C2=CC(=C3C(=C2N)C(=O)C4=C(C=CC(=C4C3=O)N)O)O)O
What is the CAS number of Disperse Blue BGL?
CAS number: 13716-91-1
What is the XLogP3-AA value of Disperse Blue BGL?
XLogP3-AA: 3.2
What is the hydrogen bond donor count of Disperse Blue BGL?
Hydrogen Bond Donor Count: 5
Download
