What is the PubChem CID of BASIC RED 46?
The PubChem CID of BASIC RED 46 is 12011963.
What is the molecular formula of BASIC RED 46?
The molecular formula of BASIC RED 46 is C18H21BrN6.
What is the molecular weight of BASIC RED 46?
The molecular weight of BASIC RED 46 is 401.3 g/mol.
What is the IUPAC name of BASIC RED 46?
The IUPAC name of BASIC RED 46 is N-benzyl-4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-N-methylaniline;bromide.
What is the InChI of BASIC RED 46?
The InChI of BASIC RED 46 is InChI=1S/C18H21N6.BrH/c1-22(13-15-7-5-4-6-8-15)17-11-9-16(10-12-17)20-21-18-23(2)14-19-24(18)3;/h4-12,14H,13H2,1-3H3;1H/q+1;/p-1.
What is the InChIKey of BASIC RED 46?
The InChIKey of BASIC RED 46 is SYHRPJPCZWZVSR-UHFFFAOYSA-M.
What is the CAS number of BASIC RED 46?
The CAS number of BASIC RED 46 is 12221-69-1.
What is the UNII of BASIC RED 46?
The UNII of BASIC RED 46 is 58KJM7T349.
What is the hydrogen bond donor count of BASIC RED 46?
The hydrogen bond donor count of BASIC RED 46 is 0.
Is BASIC RED 46 a canonicalized compound?
Yes, BASIC RED 46 is a canonicalized compound.