As a raw material, 4-Butoxy-3,5-dichlorophenylboronic acid has a high yield to synthesize biphenyl compounds.
What is the molecular formula of 4-Butoxy-3,5-dichlorophenylboronic acid?
The molecular formula of 4-Butoxy-3,5-dichlorophenylboronic acid is C10H13BCl2O3.
What are the synonyms for 4-Butoxy-3,5-dichlorophenylboronic acid?
The synonyms for 4-Butoxy-3,5-dichlorophenylboronic acid are 1218790-72-7, (4-Butoxy-3,5-dichlorophenyl)boronic acid, and (4-Butoxy-3,5-dichlorophenyl)boronicacid.
What is the molecular weight of 4-Butoxy-3,5-dichlorophenylboronic acid?
The molecular weight of 4-Butoxy-3,5-dichlorophenylboronic acid is 262.92 g/mol.
When was 4-Butoxy-3,5-dichlorophenylboronic acid created?
4-Butoxy-3,5-dichlorophenylboronic acid was created on June 21, 2011.
When was 4-Butoxy-3,5-dichlorophenylboronic acid last modified?
4-Butoxy-3,5-dichlorophenylboronic acid was last modified on December 2, 2023.
What is the IUPAC name of 4-Butoxy-3,5-dichlorophenylboronic acid?
The IUPAC name of 4-Butoxy-3,5-dichlorophenylboronic acid is (4-butoxy-3,5-dichlorophenyl)boronic acid.
What is the InChI of 4-Butoxy-3,5-dichlorophenylboronic acid?
The InChI of 4-Butoxy-3,5-dichlorophenylboronic acid is InChI=1S/C10H13BCl2O3/c1-2-3-4-16-10-8(12)5-7(11(14)15)6-9(10)13/h5-6,14-15H,2-4H2,1H3.
What is the InChIKey of 4-Butoxy-3,5-dichlorophenylboronic acid?
The InChIKey of 4-Butoxy-3,5-dichlorophenylboronic acid is CZGPPYHWISSCGP-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Butoxy-3,5-dichlorophenylboronic acid?
The Canonical SMILES of 4-Butoxy-3,5-dichlorophenylboronic acid is B(C1=CC(=C(C(=C1)Cl)OCCCC)Cl)(O)O.
What is the CAS number of 4-Butoxy-3,5-dichlorophenylboronic acid?
The CAS number of 4-Butoxy-3,5-dichlorophenylboronic acid is 1218790-72-7.
※ Please kindly note that our products are for research use only.