What is the molecular formula of Glycidamide-13C3?
The molecular formula of Glycidamide-13C3 is C3H5NO2.
What are the synonyms for Glycidamide-13C3?
The synonyms for Glycidamide-13C3 are Glycidamide- 13C3, Glycidamide-13C3, 1216449-31-8, and (2,3-13C2)oxirane-2-carboxamide.
What is the molecular weight of Glycidamide-13C3?
The molecular weight of Glycidamide-13C3 is 90.056 g/mol.
When was Glycidamide-13C3 created?
Glycidamide-13C3 was created on July 26, 2010.
When was Glycidamide-13C3 last modified?
Glycidamide-13C3 was last modified on October 21, 2023.
What is the IUPAC name of Glycidamide-13C3?
The IUPAC name of Glycidamide-13C3 is (2,3-13C2)oxirane-2-carboxamide.
What is the InChI of Glycidamide-13C3?
The InChI of Glycidamide-13C3 is InChI=1S/C3H5NO2/c4-3(5)2-1-6-2/h2H,1H2,(H2,4,5)/i1+1,2+1,3+1.
What is the InChIKey of Glycidamide-13C3?
The InChIKey of Glycidamide-13C3 is FMAZQSYXRGRESX-VMIGTVKRSA-N.
How many hydrogen bond donor count does Glycidamide-13C3 have?
Glycidamide-13C3 has 1 hydrogen bond donor count.
How many hydrogen bond acceptor count does Glycidamide-13C3 have?
Glycidamide-13C3 has 2 hydrogen bond acceptor count.