What is the molecular formula of 2,5-Dimethylfuran-d6?
The molecular formula is C6H8O.
What is the molecular weight of 2,5-Dimethylfuran-d6?
The molecular weight is 102.16 g/mol.
When was 2,5-Dimethylfuran-d6 created?
It was created on November 13, 2013.
When was 2,5-Dimethylfuran-d6 last modified?
It was last modified on October 21, 2023.
What is the IUPAC name of 2,5-Dimethylfuran-d6?
The IUPAC name is 3,4-dideuterio-2-(deuteriomethyl)-5-(trideuteriomethyl)furan.
What is the InChI of 2,5-Dimethylfuran-d6?
The InChI is InChI=1S/C6H8O/c1-5-3-4-6(2)7-5/h3-4H,1-2H3/i1D,2D3,3D,4D.
What is the InChIKey of 2,5-Dimethylfuran-d6?
The InChIKey is GSNUFIFRDBKVIE-SPDFDVHRSA-N.
What is the canonical SMILES of 2,5-Dimethylfuran-d6?
The canonical SMILES is CC1=CC=C(O1)C.
What is the computed XLogP3 value for 2,5-Dimethylfuran-d6?
The computed XLogP3 value is 2.2.
How many heavy atoms are there in 2,5-Dimethylfuran-d6?
There are 7 heavy atoms in 2,5-Dimethylfuran-d6.