What is the molecular formula of Methyl 5-bromo-3-chloropicolinate?
The molecular formula of Methyl 5-bromo-3-chloropicolinate is C7H5BrClNO2.
What are the synonyms of Methyl 5-bromo-3-chloropicolinate?
The synonyms of Methyl 5-bromo-3-chloropicolinate are methyl 5-bromo-3-chloropyridine-2-carboxylate, 5-BROMO-3-CHLORO-2-PYRIDINECARBOXYLIC ACID METHYL ESTER, and Methyl 5-bromo-3-chloro-pyridine-2-carboxylate.
What is the molecular weight of Methyl 5-bromo-3-chloropicolinate?
The molecular weight of Methyl 5-bromo-3-chloropicolinate is 250.48 g/mol.
What is the IUPAC name of Methyl 5-bromo-3-chloropicolinate?
The IUPAC name of Methyl 5-bromo-3-chloropicolinate is methyl 5-bromo-3-chloropyridine-2-carboxylate.
What is the InChI of Methyl 5-bromo-3-chloropicolinate?
The InChI of Methyl 5-bromo-3-chloropicolinate is InChI=1S/C7H5BrClNO2/c1-12-7(11)6-5(9)2-4(8)3-10-6/h2-3H,1H3.
What is the InChIKey of Methyl 5-bromo-3-chloropicolinate?
The InChIKey of Methyl 5-bromo-3-chloropicolinate is QBNSPYFGGCZDJG-UHFFFAOYSA-N.
What is the canonical SMILES of Methyl 5-bromo-3-chloropicolinate?
The canonical SMILES of Methyl 5-bromo-3-chloropicolinate is COC(=O)C1=C(C=C(C=N1)Br)Cl.
What is the CAS number of Methyl 5-bromo-3-chloropicolinate?
The CAS number of Methyl 5-bromo-3-chloropicolinate is 1214336-41-0.
What is the European Community (EC) number of Methyl 5-bromo-3-chloropicolinate?
The European Community (EC) number of Methyl 5-bromo-3-chloropicolinate is 810-921-7.
Is Methyl 5-bromo-3-chloropicolinate a canonicalized compound?
Yes, Methyl 5-bromo-3-chloropicolinate is a canonicalized compound.
※ Please kindly note that our products are for research use only.
Download
