What is the molecular formula of 10-methylphenothiazine?
The molecular formula of 10-methylphenothiazine is C13H11NS.
What is the molecular weight of 10-methylphenothiazine?
The molecular weight of 10-methylphenothiazine is 213.30 g/mol.
What is the IUPAC name of 10-methylphenothiazine?
The IUPAC name of 10-methylphenothiazine is 10-methylphenothiazine.
What is the InChI of 10-methylphenothiazine?
The InChI of 10-methylphenothiazine is InChI=1S/C13H11NS/c1-14-10-6-2-4-8-12(10)15-13-9-5-3-7-11(13)14/h2-9H,1H3.
What is the InChIKey of 10-methylphenothiazine?
The InChIKey of 10-methylphenothiazine is QXBUYALKJGBACG-UHFFFAOYSA-N.
What is the canonical SMILES of 10-methylphenothiazine?
The canonical SMILES of 10-methylphenothiazine is CN1C2=CC=CC=C2SC3=CC=CC=C31.
What is the CAS number of 10-methylphenothiazine?
The CAS number of 10-methylphenothiazine is 1207-72-3.
What is the EC number of 10-methylphenothiazine?
The EC number of 10-methylphenothiazine is 214-896-8.
What is the XLogP3 value of 10-methylphenothiazine?
The XLogP3 value of 10-methylphenothiazine is 4.2.
Is 10-methylphenothiazine a canonicalized compound?
Yes, 10-methylphenothiazine is a canonicalized compound.