What is the molecular formula of N-Phenyldiethanolamine?
The molecular formula of N-Phenyldiethanolamine is C10H15NO2.
What is the molecular weight of N-Phenyldiethanolamine?
The molecular weight of N-Phenyldiethanolamine is 181.23 g/mol.
What is the IUPAC name of N-Phenyldiethanolamine?
The IUPAC name of N-Phenyldiethanolamine is 2-[N-(2-hydroxyethyl)anilino]ethanol.
What is the InChI of N-Phenyldiethanolamine?
The InChI of N-Phenyldiethanolamine is InChI=1S/C10H15NO2/c12-8-6-11(7-9-13)10-4-2-1-3-5-10/h1-5,12-13H,6-9H2.
What is the InChIKey of N-Phenyldiethanolamine?
The InChIKey of N-Phenyldiethanolamine is OJPDDQSCZGTACX-UHFFFAOYSA-N.
What is the CAS number of N-Phenyldiethanolamine?
The CAS number of N-Phenyldiethanolamine is 120-07-0.
How many hydrogen bond donor counts does N-Phenyldiethanolamine have?
N-Phenyldiethanolamine has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does N-Phenyldiethanolamine have?
N-Phenyldiethanolamine has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does N-Phenyldiethanolamine have?
N-Phenyldiethanolamine has 5 rotatable bond counts.
What is the topological polar surface area of N-Phenyldiethanolamine?
The topological polar surface area of N-Phenyldiethanolamine is 43.7 Ų.