What is the molecular formula of 1,3-Dichlorobutane?
The molecular formula of 1,3-Dichlorobutane is C4H8Cl2.
What is the molecular weight of 1,3-Dichlorobutane?
The molecular weight of 1,3-Dichlorobutane is 127.01 g/mol.
What is the IUPAC name of 1,3-Dichlorobutane?
The IUPAC name of 1,3-Dichlorobutane is 1,3-dichlorobutane.
What is the InChI of 1,3-Dichlorobutane?
The InChI of 1,3-Dichlorobutane is InChI=1S/C4H8Cl2/c1-4(6)2-3-5/h4H,2-3H2,1H3.
What is the InChIKey of 1,3-Dichlorobutane?
The InChIKey of 1,3-Dichlorobutane is QBGVARBIQGHVKR-UHFFFAOYSA-N.
What is the canonical SMILES of 1,3-Dichlorobutane?
The canonical SMILES of 1,3-Dichlorobutane is CC(CCCl)Cl.
What is the CAS number of 1,3-Dichlorobutane?
The CAS number of 1,3-Dichlorobutane is 1190-22-3.
What is the European Community (EC) number of 1,3-Dichlorobutane?
The European Community (EC) number of 1,3-Dichlorobutane is 214-718-9.
What is the XLogP3-AA value of 1,3-Dichlorobutane?
The XLogP3-AA value of 1,3-Dichlorobutane is 2.2.
Is 1,3-Dichlorobutane a canonicalized compound?
Yes, 1,3-Dichlorobutane is a canonicalized compound.