What is the PubChem CID of the compound described?
The PubChem CID of the compound described is 53403424.
What is the molecular formula of the compound?
The molecular formula of the compound is C44H28N2.
What are some synonyms of the compound?
Some synonyms of the compound are 1174006-43-92,9-BIS(NAPHTHALEN-2-YL)-4,7-DIPHENYL-1,10-PHENANTHROLINE, Nbphen, 2,9-dinaphthalen-2-yl-4,7-diphenyl-1,10-phenanthroline, and 2,9-di(naphthalen-2-yl)-4,7-diphenyl-1,10-phenanthroline.
What is the molecular weight of the compound?
The molecular weight of the compound is 584.7 g/mol.
When was the compound created and modified in PubChem?
The compound was created on October 30, 2011, and last modified on December 30, 2023.
What is the IUPAC Name of the compound?
The IUPAC Name of the compound is 2,9-dinaphthalen-2-yl-4,7-diphenyl-1,10-phenanthroline.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C44H28N2/c1-3-13-31(14-4-1)39-27-41(35-21-19-29-11-7-9-17-33(29)25-35)45-43-37(39)23-24-38-40(32-15-5-2-6-16-32)28-42(46-44(38)43)36-22-20-30-12-8-10-18-34(30)26-36/h1-28H.
What is the InChIKey of the compound?
The InChIKey of the compound is XESMNQMWRSEIET-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is C1=CC=C(C=C1)C2=CC(=NC3=C2C=CC4=C3N=C(C=C4C5=CC=CC=C5)C6=CC7=CC=CC=C7C=C6)C8=CC9=CC=CC=C9C=C8.
What is the CAS number of the compound?
The CAS number of the compound is 1174006-43-9.
Download
