What is the molecular formula of 3-Fluoroiodobenzene?
The molecular formula of 3-Fluoroiodobenzene is C6H4FI.
What is the molecular weight of 3-Fluoroiodobenzene?
The molecular weight of 3-Fluoroiodobenzene is 222.00 g/mol.
What is the IUPAC Name of 3-Fluoroiodobenzene?
The IUPAC Name of 3-Fluoroiodobenzene is 1-fluoro-3-iodobenzene.
What is the InChI of 3-Fluoroiodobenzene?
The InChI of 3-Fluoroiodobenzene is InChI=1S/C6H4FI/c7-5-2-1-3-6(8)4-5/h1-4H.
What is the InChIKey of 3-Fluoroiodobenzene?
The InChIKey of 3-Fluoroiodobenzene is VSKSBSORLCDRHS-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Fluoroiodobenzene?
The Canonical SMILES of 3-Fluoroiodobenzene is C1=CC(=CC(=C1)I)F.
What is the CAS number of 3-Fluoroiodobenzene?
The CAS number of 3-Fluoroiodobenzene is 1121-86-4.
What is the European Community (EC) number of 3-Fluoroiodobenzene?
The European Community (EC) number of 3-Fluoroiodobenzene is 214-339-9.
What is the DSSTox Substance ID of 3-Fluoroiodobenzene?
The DSSTox Substance ID of 3-Fluoroiodobenzene is DTXSID1061524.
Is 3-Fluoroiodobenzene considered a canonicalized compound?
Yes, 3-Fluoroiodobenzene is considered a canonicalized compound.
Download
