What is the molecular formula of 2-Chloroethyl stearate?
The molecular formula of 2-Chloroethyl stearate is C20H39ClO2.
What is the molecular weight of 2-Chloroethyl stearate?
The molecular weight of 2-Chloroethyl stearate is 347.0 g/mol.
What is the IUPAC name of 2-Chloroethyl stearate?
The IUPAC name of 2-Chloroethyl stearate is 2-chloroethyl octadecanoate.
What is the InChI of 2-Chloroethyl stearate?
The InChI of 2-Chloroethyl stearate is InChI=1S/C20H39ClO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)23-19-18-21/h2-19H2,1H3.
What is the InChIKey of 2-Chloroethyl stearate?
The InChIKey of 2-Chloroethyl stearate is QLBIYHGOHHPBCC-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chloroethyl stearate?
The canonical SMILES of 2-Chloroethyl stearate is CCCCCCCCCCCCCCCCCC(=O)OCCCl.
What is the CAS number of 2-Chloroethyl stearate?
The CAS number of 2-Chloroethyl stearate is 1119-75-1.
What is the UNII of 2-Chloroethyl stearate?
The UNII of 2-Chloroethyl stearate is 3BR0460WU5.
What is the XLogP3-AA value of 2-Chloroethyl stearate?
The XLogP3-AA value of 2-Chloroethyl stearate is 9.1.
How many rotatable bond counts are there in 2-Chloroethyl stearate?
There are 19 rotatable bond counts in 2-Chloroethyl stearate.