What is the molecular formula of 1-Bromo-2,3,4,5-tetrafluorobenzene?
The molecular formula of 1-Bromo-2,3,4,5-tetrafluorobenzene is C6HBrF4.
What is the molecular weight of 1-Bromo-2,3,4,5-tetrafluorobenzene?
The molecular weight of 1-Bromo-2,3,4,5-tetrafluorobenzene is 228.97 g/mol.
What is the IUPAC name of 1-Bromo-2,3,4,5-tetrafluorobenzene?
The IUPAC name of 1-Bromo-2,3,4,5-tetrafluorobenzene is 1-bromo-2,3,4,5-tetrafluorobenzene.
What is the InChI of 1-Bromo-2,3,4,5-tetrafluorobenzene?
The InChI of 1-Bromo-2,3,4,5-tetrafluorobenzene is InChI=1S/C6HBrF4/c7-2-1-3(8)5(10)6(11)4(2)9/h1H.
What is the InChIKey of 1-Bromo-2,3,4,5-tetrafluorobenzene?
The InChIKey of 1-Bromo-2,3,4,5-tetrafluorobenzene is BUYSIDPAOVWMQX-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Bromo-2,3,4,5-tetrafluorobenzene?
The canonical SMILES of 1-Bromo-2,3,4,5-tetrafluorobenzene is C1=C(C(=C(C(=C1Br)F)F)F)F.
What is the CAS number of 1-Bromo-2,3,4,5-tetrafluorobenzene?
The CAS number of 1-Bromo-2,3,4,5-tetrafluorobenzene is 1074-91-5.
What is the EC number of 1-Bromo-2,3,4,5-tetrafluorobenzene?
The EC number of 1-Bromo-2,3,4,5-tetrafluorobenzene is 214-048-7.
What is the DSSTox Substance ID of 1-Bromo-2,3,4,5-tetrafluorobenzene?
The DSSTox Substance ID of 1-Bromo-2,3,4,5-tetrafluorobenzene is DTXSID50148042.
Is 1-Bromo-2,3,4,5-tetrafluorobenzene a canonicalized compound?
Yes, 1-Bromo-2,3,4,5-tetrafluorobenzene is a canonicalized compound.