What is the molecular formula of 2-Fluoro-5-(morpholine-4-carbonyl)phenylboronic acid?
The molecular formula is C11H13BFNO4.
What are the synonyms for 2-Fluoro-5-(morpholine-4-carbonyl)phenylboronic acid?
The synonyms include 1072951-41-7, 2-Fluoro-5-(morpholine-4-carbonyl)phenylboronic acid, (2-Fluoro-5-(morpholine-4-carbonyl)phenyl)boronic acid, and more.
What is the computed molecular weight of 2-Fluoro-5-(morpholine-4-carbonyl)phenylboronic acid?
The computed molecular weight is 253.04 g/mol.
When was the compound created?
The compound was created on July 26, 2010.
When was the compound last modified?
The compound was last modified on December 2, 2023.
What is the IUPAC name of 2-Fluoro-5-(morpholine-4-carbonyl)phenylboronic acid?
The IUPAC name is [2-fluoro-5-(morpholine-4-carbonyl)phenyl]boronic acid.
What is the InChI of 2-Fluoro-5-(morpholine-4-carbonyl)phenylboronic acid?
The InChI is InChI=1S/C11H13BFNO4/c13-10-2-1-8(7-9(10)12(16)17)11(15)14-3-5-18-6-4-14/h1-2,7,16-17H,3-6H2.
What is the InChIKey of 2-Fluoro-5-(morpholine-4-carbonyl)phenylboronic acid?
The InChIKey is PGPWWCUYTSKDEA-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Fluoro-5-(morpholine-4-carbonyl)phenylboronic acid?
The canonical SMILES is B(C1=C(C=CC(=C1)C(=O)N2CCOCC2)F)(O)O.
What is the CAS number of 2-Fluoro-5-(morpholine-4-carbonyl)phenylboronic acid?
The CAS number is 1072951-41-7.
※ Please kindly note that our products are for research use only.