What is the molecular formula of 4-Bromochlorobenzene?
The molecular formula of 4-Bromochlorobenzene is C6H4BrCl.
What is the molecular weight of 4-Bromochlorobenzene?
The molecular weight of 4-Bromochlorobenzene is 191.45 g/mol.
What is the IUPAC name of 4-Bromochlorobenzene?
The IUPAC name of 4-Bromochlorobenzene is 1-bromo-4-chlorobenzene.
What is the InChI of 4-Bromochlorobenzene?
The InChI of 4-Bromochlorobenzene is InChI=1S/C6H4BrCl/c7-5-1-3-6(8)4-2-5/h1-4H.
What is the InChIKey of 4-Bromochlorobenzene?
The InChIKey of 4-Bromochlorobenzene is NHDODQWIKUYWMW-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromochlorobenzene?
The canonical SMILES of 4-Bromochlorobenzene is C1=CC(=CC=C1Cl)Br.
What is the CAS number of 4-Bromochlorobenzene?
The CAS number of 4-Bromochlorobenzene is 106-39-8.
What is the European Community (EC) number of 4-Bromochlorobenzene?
The European Community (EC) number of 4-Bromochlorobenzene is 203-392-3.
What is the UNII of 4-Bromochlorobenzene?
The UNII of 4-Bromochlorobenzene is LXY3B1SO4F.
Is 4-Bromochlorobenzene a canonicalized compound?
Yes, 4-Bromochlorobenzene is a canonicalized compound.