What is the molecular formula of 3,5-Dimethyl-4-iodoisoxazole?
The molecular formula is C5H6INO.
What is the synonyms of 3,5-Dimethyl-4-iodoisoxazole?
The synonyms are 3,5-Dimethyl-4-iodoisoxazole, 10557-85-4, 4-Iodo-3,5-dimethylisoxazole, 4-iodo-3,5-dimethyl-1,2-oxazole, Isoxazole, 4-iodo-3,5-dimethyl-, and more.
What is the molecular weight of 3,5-Dimethyl-4-iodoisoxazole?
The molecular weight is 223.01 g/mol.
What is the IUPAC name of 3,5-Dimethyl-4-iodoisoxazole?
The IUPAC name is 4-iodo-3,5-dimethyl-1,2-oxazole.
What is the InChI code of 3,5-Dimethyl-4-iodoisoxazole?
The InChI code is InChI=1S/C5H6INO/c1-3-5(6)4(2)8-7-3/h1-2H3.
What is the InChIKey of 3,5-Dimethyl-4-iodoisoxazole?
The InChIKey is NMNOXVWRJISEFE-UHFFFAOYSA-N.
What is the CAS number of 3,5-Dimethyl-4-iodoisoxazole?
The CAS number is 10557-85-4.
What is the European Community (EC) Number of 3,5-Dimethyl-4-iodoisoxazole?
The European Community (EC) number is 675-469-3.
Is 3,5-Dimethyl-4-iodoisoxazole a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.
※ Please kindly note that our products are for research use only.