What is the molecular formula of 2-(Fmoc-amino)ethanol?
The molecular formula of 2-(Fmoc-amino)ethanol is C17H17NO3.
What is the molecular weight of 2-(Fmoc-amino)ethanol?
The molecular weight of 2-(Fmoc-amino)ethanol is 283.32 g/mol.
What is the IUPAC name of 2-(Fmoc-amino)ethanol?
The IUPAC name of 2-(Fmoc-amino)ethanol is 9H-fluoren-9-ylmethyl N-(2-hydroxyethyl)carbamate.
What is the InChI of 2-(Fmoc-amino)ethanol?
The InChI of 2-(Fmoc-amino)ethanol is InChI=1S/C17H17NO3/c19-10-9-18-17(20)21-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16,19H,9-11H2,(H,18,20).
What is the InChIKey of 2-(Fmoc-amino)ethanol?
The InChIKey of 2-(Fmoc-amino)ethanol is XLIFWDZVNRWYKV-UHFFFAOYSA-N.
What is the canonical SMILES of 2-(Fmoc-amino)ethanol?
The canonical SMILES of 2-(Fmoc-amino)ethanol is C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCO.
What is the CAS number of 2-(Fmoc-amino)ethanol?
The CAS number of 2-(Fmoc-amino)ethanol is 105496-31-9.
What is the EC number of 2-(Fmoc-amino)ethanol?
The EC number of 2-(Fmoc-amino)ethanol is 626-390-8.
Is 2-(Fmoc-amino)ethanol a canonicalized compound?
Yes, 2-(Fmoc-amino)ethanol is a canonicalized compound.