What is the molecular formula of 1-Hexyn-3-ol?
The molecular formula of 1-Hexyn-3-ol is C6H10O.
What is the molecular weight of 1-Hexyn-3-ol?
The molecular weight of 1-Hexyn-3-ol is 98.14 g/mol.
What is the IUPAC Name of 1-Hexyn-3-ol?
The IUPAC Name of 1-Hexyn-3-ol is hex-1-yn-3-ol.
What is the InChI of 1-Hexyn-3-ol?
The InChI of 1-Hexyn-3-ol is InChI=1S/C6H10O/c1-3-5-6(7)4-2/h2,6-7H,3,5H2,1H3.
What is the InChIKey of 1-Hexyn-3-ol?
The InChIKey of 1-Hexyn-3-ol is LTFTWJYRQNTCHI-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Hexyn-3-ol?
The canonical SMILES of 1-Hexyn-3-ol is CCCC(C#C)O.
What is the CAS number of 1-Hexyn-3-ol?
The CAS number of 1-Hexyn-3-ol is 105-31-7.
What is the European Community (EC) Number of 1-Hexyn-3-ol?
The European Community (EC) Number of 1-Hexyn-3-ol is 203-286-7.
What is the UNII of 1-Hexyn-3-ol?
The UNII of 1-Hexyn-3-ol is R9B2WH0KBL.
Is 1-Hexyn-3-ol a canonicalized compound?
Yes, 1-Hexyn-3-ol is a canonicalized compound according to PubChem.