What is the molecular formula of 4-Methoxybenzyl alcohol?
The molecular formula is C8H10O2.
What is the molecular weight of 4-Methoxybenzyl alcohol?
The molecular weight is 138.16 g/mol.
What are some synonyms for 4-Methoxybenzyl alcohol?
Some synonyms include 4-Methoxyphenylmethanol, Anisyl alcohol, and Anise alcohol.
Is 4-Methoxybenzyl alcohol a natural product?
Yes, 4-Methoxybenzyl alcohol is a natural product found in Vanilla pompona, Illicium verum, and other organisms.
What is the IUPAC name of 4-Methoxybenzyl alcohol?
The IUPAC name is (4-methoxyphenyl)methanol.
What is the InChI of 4-Methoxybenzyl alcohol?
The InChI is InChI=1S/C8H10O2/c1-10-8-4-2-7(6-9)3-5-8/h2-5,9H,6H2,1H3.
What is the InChIKey of 4-Methoxybenzyl alcohol?
The InChIKey is MSHFRERJPWKJFX-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 4-Methoxybenzyl alcohol have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 4-Methoxybenzyl alcohol have?
It has 2 hydrogen bond acceptor counts.
What is the topological polar surface area of 4-Methoxybenzyl alcohol?
The topological polar surface area is 29.5 Ų.