What is the molecular formula of bromperidol?
The molecular formula of bromperidol is C21H23BrFNO2.
What is the molecular weight of bromperidol?
The molecular weight of bromperidol is 420.3 g/mol.
When was bromperidol created?
Bromperidol was created on March 25, 2005.
What is the IUPAC name of bromperidol?
The IUPAC name of bromperidol is 4-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one.
What is the InChI key of bromperidol?
The InChI key of bromperidol is RKLNONIVDFXQRX-UHFFFAOYSA-N.
What is the canonical SMILES of bromperidol?
The canonical SMILES of bromperidol is C1CN(CCC1(C2=CC=C(C=C2)Br)O)CCCC(=O)C3=CC=C(C=C3)F.
What is the CAS number of bromperidol?
The CAS number of bromperidol is 10457-90-6.
What is the EC number of bromperidol?
The EC number of bromperidol is 233-943-3.
What is the ChEMBL ID of bromperidol?
The ChEMBL ID of bromperidol is CHEMBL28218.
What is the Wikipedia page for bromperidol?
The Wikipedia page for bromperidol is titled "Bromperidol".