What is the molecular formula of 4-Methylanisole?
The molecular formula of 4-Methylanisole is C8H10O.
What is the molecular weight of 4-Methylanisole?
The molecular weight of 4-Methylanisole is 122.16 g/mol.
What is the IUPAC name of 4-Methylanisole?
The IUPAC name of 4-Methylanisole is 1-methoxy-4-methylbenzene.
What is the InChI of 4-Methylanisole?
The InChI of 4-Methylanisole is InChI=1S/C8H10O/c1-7-3-5-8(9-2)6-4-7/h3-6H,1-2H3.
What is the InChIKey of 4-Methylanisole?
The InChIKey of 4-Methylanisole is CHLICZRVGGXEOD-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Methylanisole?
The canonical SMILES of 4-Methylanisole is CC1=CC=C(C=C1)OC.
What is the CAS number of 4-Methylanisole?
The CAS number of 4-Methylanisole is 104-93-8.
What is the XLogP3 value of 4-Methylanisole?
The XLogP3 value of 4-Methylanisole is 2.7.
How many hydrogen bond donor counts does 4-Methylanisole have?
4-Methylanisole has 0 hydrogen bond donor counts.
What is the topological polar surface area of 4-Methylanisole?
The topological polar surface area of 4-Methylanisole is 9.2Ų.