What is the IUPAC name of the compound?
The IUPAC name of the compound is 3-prop-2-enoxybenzoic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C10H10O3/c1-2-6-13-9-5-3-4-8(7-9)10(11)12/h2-5,7H,1,6H2,(H,11,12).
What is the InChIKey of the compound?
The InChIKey of the compound is ZMEBKXNYMWXFEX-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C=CCOC1=CC=CC(=C1)C(=O)O.
What is the molecular weight of the compound?
The molecular weight of the compound is 178.18 g/mol.
What is the XLogP3 value of the compound?
The XLogP3 value of the compound is 2.7.
How many hydrogen bond donor atoms are in the compound?
The compound has 1 hydrogen bond donor atom.
How many hydrogen bond acceptor atoms are in the compound?
The compound has 3 hydrogen bond acceptor atoms.
How many rotatable bonds are in the compound?
The compound has 4 rotatable bonds.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 46.5Ų.