What is the CID of 3-Bromobenzylamine in PubChem?
The CID of 3-Bromobenzylamine in PubChem is 457587.
What is the molecular formula of 3-Bromobenzylamine?
The molecular formula of 3-Bromobenzylamine is C7H8BrN.
What are the synonyms of 3-Bromobenzylamine?
The synonyms of 3-Bromobenzylamine are "3-bromophenyl)methanamine" and "Benzenemethanamine, 3-bromo-" among others.
What is the molecular weight of 3-Bromobenzylamine?
The molecular weight of 3-Bromobenzylamine is 186.05 g/mol.
What is the IUPAC name of 3-Bromobenzylamine?
The IUPAC name of 3-Bromobenzylamine is "(3-bromophenyl)methanamine".
What is the InChI of 3-Bromobenzylamine?
The InChI of 3-Bromobenzylamine is "InChI=1S/C7H8BrN/c8-7-3-1-2-6(4-7)5-9/h1-4H,5,9H2".
What is the InChIKey of 3-Bromobenzylamine?
The InChIKey of 3-Bromobenzylamine is "SUYJXERPRICYRX-UHFFFAOYSA-N".
What is the Canonical SMILES of 3-Bromobenzylamine?
The Canonical SMILES of 3-Bromobenzylamine is "C1=CC(=CC(=C1)Br)CN".
What is the CAS number of 3-Bromobenzylamine?
The CAS number of 3-Bromobenzylamine is 10269-01-9.
What is the XLogP3 value of 3-Bromobenzylamine?
The XLogP3 value of 3-Bromobenzylamine is 1.8.