Through chemical modification, the enzyme inhibitor prepared by 1-Methyl-3-(trifluoromethyl)pyrazole-5-boronic acid pinacol ester can target the index tumor diseases.
What is the molecular formula of 1-Methyl-3-(trifluoromethyl)pyrazole-5-boronic acid pinacol ester?
The molecular formula is C11H16BF3N2O2.
What is the molecular weight of 1-Methyl-3-(trifluoromethyl)pyrazole-5-boronic acid pinacol ester?
The molecular weight is 276.07 g/mol.
What is the IUPAC name of 1-Methyl-3-(trifluoromethyl)pyrazole-5-boronic acid pinacol ester?
The IUPAC name is 1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazole.
What is the InChI key of 1-Methyl-3-(trifluoromethyl)pyrazole-5-boronic acid pinacol ester?
The InChI key is CQKAWCKCEPHXAE-UHFFFAOYSA-N.
What is the canonical SMILES representation of 1-Methyl-3-(trifluoromethyl)pyrazole-5-boronic acid pinacol ester?
The canonical SMILES representation is B1(OC(C(O1)(C)C)(C)C)C2=CC(=NN2C)C(F)(F)F.
What is the CAS number of 1-Methyl-3-(trifluoromethyl)pyrazole-5-boronic acid pinacol ester?
The CAS number is 1025719-23-6.
What is the European Community (EC) number of 1-Methyl-3-(trifluoromethyl)pyrazole-5-boronic acid pinacol ester?
The European Community (EC) number is 687-323-6.
What is the ChEMBL ID of 1-Methyl-3-(trifluoromethyl)pyrazole-5-boronic acid pinacol ester?
The ChEMBL ID is CHEMBL5027660.
Is 1-Methyl-3-(trifluoromethyl)pyrazole-5-boronic acid pinacol ester a canonical compound?
Yes, it is a canonical compound.
※ Please kindly note that our products are for research use only.
Download
![1-Boc-5-bromopyrrolo[2,3-b]pyridine-3-boronic acid,pinacol ester](https://resource.alfa-chemistry.com/structure/1025719-14-5.gif)
