What is the molecular formula of 2-Bromo-3-nitrophenol?
The molecular formula of 2-Bromo-3-nitrophenol is C6H4BrNO3.
What is the molecular weight of 2-Bromo-3-nitrophenol?
The molecular weight of 2-Bromo-3-nitrophenol is 218.00 g/mol.
What is the IUPAC name of 2-Bromo-3-nitrophenol?
The IUPAC name of 2-Bromo-3-nitrophenol is 2-bromo-3-nitrophenol.
What is the InChI of 2-Bromo-3-nitrophenol?
The InChI of 2-Bromo-3-nitrophenol is InChI=1S/C6H4BrNO3/c7-6-4(8(10)11)2-1-3-5(6)9/h1-3,9H.
What is the InChIKey of 2-Bromo-3-nitrophenol?
The InChIKey of 2-Bromo-3-nitrophenol is HRVRWIBVVHOHNN-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Bromo-3-nitrophenol?
The Canonical SMILES of 2-Bromo-3-nitrophenol is C1=CC(=C(C(=C1)O)Br)[N+](=O)[O-].
What is the CAS number of 2-Bromo-3-nitrophenol?
The CAS number of 2-Bromo-3-nitrophenol is 101935-40-4.
What is the EC number of 2-Bromo-3-nitrophenol?
The EC number of 2-Bromo-3-nitrophenol is 806-650-9.
Is 2-Bromo-3-nitrophenol a canonicalized compound?
Yes, 2-Bromo-3-nitrophenol is a canonicalized compound.