What is the molecular formula of 3,5-Pridinediboronicacid?
The molecular formula of 3,5-Pridinediboronicacid is C5H7B2NO4.
What are the synonyms for 3,5-Pridinediboronicacid?
The synonyms for 3,5-Pridinediboronicacid are Pyridine-3,5-diyldiboronic acid, (5-boronopyridin-3-yl)boronic Acid, 3,5-Pyridine diboronic acid, and [5-(dihydroxyboranyl)pyridin-3-yl]boronic acid.
What is the molecular weight of 3,5-Pridinediboronicacid?
The molecular weight of 3,5-Pridinediboronicacid is 166.74 g/mol.
When was 3,5-Pridinediboronicacid created and last modified?
3,5-Pridinediboronicacid was created on September 16, 2005, and last modified on December 2, 2023.
What is the IUPAC name of 3,5-Pridinediboronicacid?
The IUPAC name of 3,5-Pridinediboronicacid is (5-boronopyridin-3-yl)boronic acid.
What is the InChI of 3,5-Pridinediboronicacid?
The InChI of 3,5-Pridinediboronicacid is InChI=1S/C5H7B2NO4/c9-6(10)4-1-5(7(11)12)3-8-2-4/h1-3,9-12H.
What is the InChIKey of 3,5-Pridinediboronicacid?
The InChIKey of 3,5-Pridinediboronicacid is NZUCYVVWSUZTQZ-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Pridinediboronicacid?
The canonical SMILES of 3,5-Pridinediboronicacid is B(C1=CC(=CN=C1)B(O)O)(O)O.
What is the CAS number of 3,5-Pridinediboronicacid?
The CAS number of 3,5-Pridinediboronicacid is 1012085-48-1.
What is the molecular weight of 3,5-Pridinediboronicacid according to PubChem?
The molecular weight of 3,5-Pridinediboronicacid is 166.74 g/mol, as computed by PubChem.