The molecular formula of the compound is C4H4BBrO2S.
What are the synonyms of the compound?
The synonyms of the compound are 101084-76-8, 3-Bromothiophene-4-boronic acid, (4-Bromothiophen-3-yl)boronic acid, 4-BROMOTHIOPHENE-3-BORONIC ACID, and Boronic acid, B-(4-bromo-3-thienyl)-.
What is the molecular weight of the compound?
The molecular weight of the compound is 206.86 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (4-bromothiophen-3-yl)boronic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C4H4BBrO2S/c6-4-2-9-1-3(4)5(7)8/h1-2,7-8H.
What is the InChIKey of the compound?
The InChIKey of the compound is GGPJEVFFYNCPJV-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B(C1=CSC=C1Br)(O)O.
What is the CAS number of the compound?
The CAS number of the compound is 101084-76-8.
What is the European Community (EC) Number of the compound?
The European Community (EC) Number of the compound is 696-565-1.
What is the formal charge of the compound?
The formal charge of the compound is 0.
※ Please kindly note that our products are for research use only.