What is the molecular formula of 4-Bromophenoxybenzene?
The molecular formula of 4-Bromophenoxybenzene is C12H9BrO.
What is the molecular weight of 4-Bromophenoxybenzene?
The molecular weight of 4-Bromophenoxybenzene is 249.10 g/mol.
Is 4-Bromophenoxybenzene soluble in water?
No, 4-Bromophenoxybenzene is insoluble or slightly soluble in water.
What is the IUPAC name of 4-Bromophenoxybenzene?
The IUPAC name of 4-Bromophenoxybenzene is 1-bromo-4-phenoxybenzene.
What is the InChIKey of 4-Bromophenoxybenzene?
The InChIKey of 4-Bromophenoxybenzene is JDUYPUMQALQRCN-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromophenoxybenzene?
The canonical SMILES of 4-Bromophenoxybenzene is C1=CC=C(C=C1)OC2=CC=C(C=C2)Br.
What is the CAS number of 4-Bromophenoxybenzene?
The CAS number of 4-Bromophenoxybenzene is 101-55-3.
What is the UNII of 4-Bromophenoxybenzene?
The UNII of 4-Bromophenoxybenzene is N19SE3QCFN.
What is the ChEMBL ID of 4-Bromophenoxybenzene?
The ChEMBL ID of 4-Bromophenoxybenzene is CHEMBL1873236.
What is the XLogP3 value of 4-Bromophenoxybenzene?
The XLogP3 value of 4-Bromophenoxybenzene is 4.4.