What is the molecular formula of 1,1-Dimethoxyheptane?
The molecular formula of 1,1-Dimethoxyheptane is C9H20O2.
What is the molecular weight of 1,1-Dimethoxyheptane?
The molecular weight of 1,1-Dimethoxyheptane is 160.25 g/mol.
What is the IUPAC name of 1,1-Dimethoxyheptane?
The IUPAC name of 1,1-Dimethoxyheptane is 1,1-dimethoxyheptane.
What is the InChI of 1,1-Dimethoxyheptane?
The InChI of 1,1-Dimethoxyheptane is InChI=1S/C9H20O2/c1-4-5-6-7-8-9(10-2)11-3/h9H,4-8H2,1-3H3.
What is the InChIKey of 1,1-Dimethoxyheptane?
The InChIKey of 1,1-Dimethoxyheptane is BBMCNYFBAIUERL-UHFFFAOYSA-N.
What is the CAS number of 1,1-Dimethoxyheptane?
The CAS number of 1,1-Dimethoxyheptane is 10032-05-0.
What is the EC number of 1,1-Dimethoxyheptane?
The EC number of 1,1-Dimethoxyheptane is 233-103-6.
What is the FEMA number of 1,1-Dimethoxyheptane?
The FEMA number of 1,1-Dimethoxyheptane is 2541.
How many hydrogen bond donors and acceptors does 1,1-Dimethoxyheptane have?
1,1-Dimethoxyheptane has 0 hydrogen bond donors and 2 hydrogen bond acceptors.