What is the molecular formula of 2-Bromo-5-fluoroaniline?
The molecular formula of 2-Bromo-5-fluoroaniline is C6H5BrFN.
What is the molecular weight of 2-Bromo-5-fluoroaniline?
The molecular weight of 2-Bromo-5-fluoroaniline is 190.01 g/mol.
What is the IUPAC name of 2-Bromo-5-fluoroaniline?
The IUPAC name of 2-Bromo-5-fluoroaniline is 2-bromo-5-fluoroaniline.
What is the InChI of 2-Bromo-5-fluoroaniline?
The InChI of 2-Bromo-5-fluoroaniline is InChI=1S/C6H5BrFN/c7-5-2-1-4(8)3-6(5)9/h1-3H,9H2.
What is the InChIKey of 2-Bromo-5-fluoroaniline?
The InChIKey of 2-Bromo-5-fluoroaniline is FWTXFEKVHSFTDQ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-5-fluoroaniline?
The canonical SMILES of 2-Bromo-5-fluoroaniline is C1=CC(=C(C=C1F)N)Br.
What is the CAS number of 2-Bromo-5-fluoroaniline?
The CAS number of 2-Bromo-5-fluoroaniline is 1003-99-2.
What is the XLogP3-AA value of 2-Bromo-5-fluoroaniline?
The XLogP3-AA value of 2-Bromo-5-fluoroaniline is 2.
How many hydrogen bond donor counts does 2-Bromo-5-fluoroaniline have?
2-Bromo-5-fluoroaniline has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Bromo-5-fluoroaniline have?
2-Bromo-5-fluoroaniline has 2 hydrogen bond acceptor counts.