What is the molecular formula of suberoyl chloride?
The molecular formula of suberoyl chloride is C8H12Cl2O2.
What are the synonyms of suberoyl chloride?
The synonyms of suberoyl chloride are Octanedioyl dichloride, 10027-07-3, and Suberoyl dichloride.
What is the molecular weight of suberoyl chloride?
The molecular weight of suberoyl chloride is 211.08 g/mol.
What is the IUPAC name of suberoyl chloride?
The IUPAC name of suberoyl chloride is octanedioyl dichloride.
What is the InChI code of suberoyl chloride?
The InChI code of suberoyl chloride is InChI=1S/C8H12Cl2O2/c9-7(11)5-3-1-2-4-6-8(10)12/h1-6H2.
What is the InChIKey of suberoyl chloride?
The InChIKey of suberoyl chloride is PUIBKAHUQOOLSW-UHFFFAOYSA-N.
What is the canonical SMILES of suberoyl chloride?
The canonical SMILES of suberoyl chloride is C(CCCC(=O)Cl)CCC(=O)Cl.
What is the CAS number of suberoyl chloride?
The CAS number of suberoyl chloride is 10027-07-3.
What is the XLogP3-AA value of suberoyl chloride?
The XLogP3-AA value of suberoyl chloride is 3.
Is suberoyl chloride a canonicalized compound?
Yes, suberoyl chloride is a canonicalized compound.