What is the PubChem CID of Carbazole-9-ethanol?
The PubChem CID of Carbazole-9-ethanol is 228287.
What is the molecular formula of Carbazole-9-ethanol?
The molecular formula of Carbazole-9-ethanol is C14H13NO.
What is the molecular weight of Carbazole-9-ethanol?
The molecular weight of Carbazole-9-ethanol is 211.26 g/mol.
What is the IUPAC name of Carbazole-9-ethanol?
The IUPAC name of Carbazole-9-ethanol is 2-carbazol-9-ylethanol.
What is the InChI of Carbazole-9-ethanol?
The InChI of Carbazole-9-ethanol is InChI=1S/C14H13NO/c16-10-9-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,16H,9-10H2.
What is the InChIKey of Carbazole-9-ethanol?
The InChIKey of Carbazole-9-ethanol is IIKVAWLYHHZRGV-UHFFFAOYSA-N.
What is the canonical SMILES of Carbazole-9-ethanol?
The canonical SMILES of Carbazole-9-ethanol is C1=CC=C2C(=C1)C3=CC=CC=C3N2CCO.
What is the CAS number of Carbazole-9-ethanol?
The CAS number of Carbazole-9-ethanol is 1484-14-6.
What is the European Community (EC) number of Carbazole-9-ethanol?
The European Community (EC) number of Carbazole-9-ethanol is 604-632-3.
Is Carbazole-9-ethanol a canonicalized compound?
Yes, Carbazole-9-ethanol is a canonicalized compound according to PubChem.