What is the molecular formula of the Calpain inhibitor I?
The molecular formula of the Calpain inhibitor I is C20H37N3O4.
What is the molecular weight of the Calpain inhibitor I?
The molecular weight of the Calpain inhibitor I is 383.5 g/mol.
What are some synonyms for the Calpain inhibitor I?
Some synonyms for the Calpain inhibitor I include MG-101 and Acetylleucyl-leucyl-norleucinal.
What is the role of the Calpain inhibitor I?
The Calpain inhibitor I has a role as a cysteine protease inhibitor.
What is the IUPAC Name of the Calpain inhibitor I?
The IUPAC Name of the Calpain inhibitor I is (2S)-2-acetamido-4-methyl-N-[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxohexan-2-yl]amino]pentan-2-yl]pentanamide.
What is the InChIKey of the Calpain inhibitor I?
The InChIKey of the Calpain inhibitor I is FMYKJLXRRQTBOR-BZSNNMDCSA-N.
What is the Canonical SMILES of the Calpain inhibitor I?
The Canonical SMILES of the Calpain inhibitor I is CCCC(C=O)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C.
What is the CAS ID of the Calpain inhibitor I?
The CAS ID of the Calpain inhibitor I is 110044-82-1.
What is the XLogP3-AA value of the Calpain inhibitor I?
The XLogP3-AA value of the Calpain inhibitor I is 3.
How many defined atom stereocenters does the Calpain inhibitor I have?
The Calpain inhibitor I has 3 defined atom stereocenters.