What is the molecular formula of 2-Butoxyethyl acrylate?
The molecular formula is C9H16O3.
What are the synonyms for 2-Butoxyethyl acrylate?
The synonyms are Butyl cellosolve acrylate, 2-butoxyethyl prop-2-enoate, and Acrylic acid, 2-butoxyethyl ester.
What is the molecular weight of 2-Butoxyethyl acrylate?
The molecular weight is 172.22 g/mol.
When was 2-Butoxyethyl acrylate created and modified?
It was created on March 26, 2005, and last modified on October 21, 2023.
What is the IUPAC name of 2-Butoxyethyl acrylate?
The IUPAC name is 2-butoxyethyl prop-2-enoate.
What is the InChI of 2-Butoxyethyl acrylate?
The InChI is InChI=1S/C9H16O3/c1-3-5-6-11-7-8-12-9(10)4-2/h4H,2-3,5-8H2,1H3.
What is the InChIKey of 2-Butoxyethyl acrylate?
The InChIKey is PTJDGKYFJYEAOK-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Butoxyethyl acrylate?
The canonical SMILES is CCCCOCCOC(=O)C=C.
What is the CAS number of 2-Butoxyethyl acrylate?
The CAS number is 7251-90-3.
What is the XLogP3-AA value of 2-Butoxyethyl acrylate?
The XLogP3-AA value is 1.8.