What is the molecular formula of Bromotriphenylmethane?
The molecular formula of Bromotriphenylmethane is C19H15Br.
What is the molecular weight of Bromotriphenylmethane?
The molecular weight of Bromotriphenylmethane is 323.2 g/mol.
What is the IUPAC name of Bromotriphenylmethane?
The IUPAC name of Bromotriphenylmethane is [bromo(diphenyl)methyl]benzene.
What is the InChI of Bromotriphenylmethane?
The InChI of Bromotriphenylmethane is InChI=1S/C19H15Br/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H.
What is the InChIKey of Bromotriphenylmethane?
The InChIKey of Bromotriphenylmethane is NZHXEWZGTQSYJM-UHFFFAOYSA-N.
What is the canonical SMILES of Bromotriphenylmethane?
The canonical SMILES of Bromotriphenylmethane is C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)Br.
What is the CAS number of Bromotriphenylmethane?
The CAS number of Bromotriphenylmethane is 596-43-0.
What is the UNII of Bromotriphenylmethane?
The UNII of Bromotriphenylmethane is EWY6H8D4L5.
What is the ChEMBL ID of Bromotriphenylmethane?
The ChEMBL ID of Bromotriphenylmethane is CHEMBL270127.
What is the XLogP3 value of Bromotriphenylmethane?
The XLogP3 value of Bromotriphenylmethane is 5.1.