What is the molecular formula of boric acid?
The molecular formula of boric acid is BH3O3 or H3BO3 or B(OH)3.
What is the molecular weight of boric acid?
The molecular weight of boric acid is 61.84 g/mol.
What are the synonyms of boric acid?
The synonyms of boric acid are Orthoboric acid, Boracic acid, Borofax, and more.
What is the IUPAC name of boric acid?
The IUPAC name of boric acid is boric acid.
What is the InChI of boric acid?
The InChI of boric acid is InChI=1S/BH3O3/c2-1(3)4/h2-4H.
What is the InChIKey of boric acid?
The InChIKey of boric acid is KGBXLFKZBHKPEV-UHFFFAOYSA-N.
What is the canonical SMILES of boric acid?
The canonical SMILES of boric acid is B(O)(O)O.
What is the CAS number of boric acid?
The CAS number of boric acid is 10043-35-3.
What is the EC number of boric acid?
The EC number of boric acid is 233-139-2.
What is the ChEMBL ID of boric acid?
The ChEMBL ID of boric acid is CHEMBL42403.