What is the molecular formula of Boc-L-4-Bromophenylalaninol?
The molecular formula of Boc-L-4-Bromophenylalaninol is C14H20BrNO3.
What is the molecular weight of Boc-L-4-Bromophenylalaninol?
The molecular weight of Boc-L-4-Bromophenylalaninol is 330.22 g/mol.
When was Boc-L-4-Bromophenylalaninol created?
Boc-L-4-Bromophenylalaninol was created on August 19, 2012.
What is the IUPAC name of Boc-L-4-Bromophenylalaninol?
The IUPAC name of Boc-L-4-Bromophenylalaninol is tert-butyl N-[(2S)-1-(4-bromophenyl)-3-hydroxypropan-2-yl]carbamate.
What is the InChI of Boc-L-4-Bromophenylalaninol?
The InChI of Boc-L-4-Bromophenylalaninol is InChI=1S/C14H20BrNO3/c1-14(2,3)19-13(18)16-12(9-17)8-10-4-6-11(15)7-5-10/h4-7,12,17H,8-9H2,1-3H3,(H,16,18)/t12-/m0/s1.
What is the InChIKey of Boc-L-4-Bromophenylalaninol?
The InChIKey of Boc-L-4-Bromophenylalaninol is WHWUXGXKXNAINU-LBPRGKRZSA-N.
What is the canonical SMILES of Boc-L-4-Bromophenylalaninol?
The canonical SMILES of Boc-L-4-Bromophenylalaninol is CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)Br)CO.
What is the isomeric SMILES of Boc-L-4-Bromophenylalaninol?
The isomeric SMILES of Boc-L-4-Bromophenylalaninol is CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)Br)CO.
What is the XLogP3-AA value of Boc-L-4-Bromophenylalaninol?
The XLogP3-AA value of Boc-L-4-Bromophenylalaninol is 3.
How many hydrogen bond donor counts does Boc-L-4-Bromophenylalaninol have?
Boc-L-4-Bromophenylalaninol has 2 hydrogen bond donor counts.
※ Please kindly note that our products are for research use only.