What is the molecular formula of Boc-D-lys(Z)-oh?
The molecular formula of Boc-D-lys(Z)-oh is C19H28N2O6.
What are the synonyms of Boc-D-lys(Z)-oh?
The synonyms of Boc-D-lys(Z)-oh are Boc-D-Lys(Z)-OH, 55878-47-2, and 76477-42-4.
What is the molecular weight of Boc-D-lys(Z)-oh?
The molecular weight of Boc-D-lys(Z)-oh is 380.4 g/mol.
What is the IUPAC name of Boc-D-lys(Z)-oh?
The IUPAC name of Boc-D-lys(Z)-oh is (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoic acid.
What is the InChI of Boc-D-lys(Z)-oh?
The InChI of Boc-D-lys(Z)-oh is InChI=1S/C19H28N2O6/c1-19(2,3)27-18(25)21-15(16(22)23)11-7-8-12-20-17(24)26-13-14-9-5-4-6-10-14/h4-6,9-10,15H,7-8,11-13H2,1-3H3,(H,20,24)(H,21,25)(H,22,23)/t15-/m1/s1.
What is the InChIKey of Boc-D-lys(Z)-oh?
The InChIKey of Boc-D-lys(Z)-oh is BDHUTRNYBGWPBL-OAHLLOKOSA-N.
What is the canonical SMILES of Boc-D-lys(Z)-oh?
The canonical SMILES of Boc-D-lys(Z)-oh is CC(C)(C)OC(=O)NC(CCCCNC(=O)OCC1=CC=CC=C1)C(=O)O.
What is the isomeric SMILES of Boc-D-lys(Z)-oh?
The isomeric SMILES of Boc-D-lys(Z)-oh is CC(C)(C)OC(=O)N[C@H](CCCCNC(=O)OCC1=CC=CC=C1)C(=O)O.
What is the CAS number of Boc-D-lys(Z)-oh?
The CAS number of Boc-D-lys(Z)-oh is 55878-47-2.
Is Boc-D-lys(Z)-oh a canonicalized compound?
Yes, Boc-D-lys(Z)-oh is a canonicalized compound.