Bis(4-vinylthiophenyl)sulfide

• Catalog Number: ACM152419788
• Product Name: Bis(4-vinylthiophenyl)sulfide
• CAS: 152419-78-8
• Category: Heterocyclic Organic Compound
• Synonyms: BIS(4-VINYLTHIOPHENYL)SULFIDE;bis(4-(vinylthio)phenyl)sulfane;Benzene,1,1-thiobis[4-(ethenylthio)-;Bis(4-vinylthiophenyl)sulfid
• Molecular Weight: 0

Custom Q&A

What is the molecular formula of Bis(4-vinylthiophenyl)sulfide?

The molecular formula is C16H14S3.

What is the IUPAC name of Bis(4-vinylthiophenyl)sulfide?

The IUPAC name is 1-ethenylsulfanyl-4-(4-ethenylsulfanylphenyl)sulfanylbenzene.

What is the InChI of Bis(4-vinylthiophenyl)sulfide?

The InChI is InChI=1S/C16H14S3/c1-3-17-13-5-9-15(10-6-13)19-16-11-7-14(8-12-16)18-4-2/h3-12H,1-2H2.

What is the InChIKey of Bis(4-vinylthiophenyl)sulfide?

The InChIKey is WQUQHXQTTKKFGY-UHFFFAOYSA-N.

What is the canonical SMILES of Bis(4-vinylthiophenyl)sulfide?

The canonical SMILES is C=CSC1=CC=C(C=C1)SC2=CC=C(C=C2)SC=C.

What is the molecular weight of Bis(4-vinylthiophenyl)sulfide?

The molecular weight is 302.5 g/mol.

What is the XLogP3-AA value of Bis(4-vinylthiophenyl)sulfide?

The XLogP3-AA value is 6.

How many hydrogen bond donor counts does Bis(4-vinylthiophenyl)sulfide have?

It does not have any hydrogen bond donor count.

How many hydrogen bond acceptor counts does Bis(4-vinylthiophenyl)sulfide have?

It has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does Bis(4-vinylthiophenyl)sulfide have?

It has 6 rotatable bond counts.