What is the molecular formula of Benzoin methyl ether?
The molecular formula of Benzoin methyl ether is C15H14O2.
What is the molecular weight of Benzoin methyl ether?
The molecular weight of Benzoin methyl ether is 226.27 g/mol.
What is the IUPAC name of Benzoin methyl ether?
The IUPAC name of Benzoin methyl ether is 2-methoxy-1,2-diphenylethanone.
What is the InChI of Benzoin methyl ether?
The InChI of Benzoin methyl ether is InChI=1S/C15H14O2/c1-17-15(13-10-6-3-7-11-13)14(16)12-8-4-2-5-9-12/h2-11,15H,1H3.
What is the InChIKey of Benzoin methyl ether?
The InChIKey of Benzoin methyl ether is BQZJOQXSCSZQPS-UHFFFAOYSA-N.
What is the canonical SMILES of Benzoin methyl ether?
The canonical SMILES of Benzoin methyl ether is COC(C1=CC=CC=C1)C(=O)C2=CC=CC=C2.
What is the CAS number of Benzoin methyl ether?
The CAS number of Benzoin methyl ether is 3524-62-7.
What is the XLogP3 value of Benzoin methyl ether?
The XLogP3 value of Benzoin methyl ether is 2.7.
How many hydrogen bond acceptors are there in Benzoin methyl ether?
There are 2 hydrogen bond acceptors in Benzoin methyl ether.