What is the molecular formula of balanol?
The molecular formula of balanol is C28H26N2O10.
What is the molecular weight of balanol?
The molecular weight of balanol is 550.5 g/mol.
What is the IUPAC name of balanol?
The IUPAC name of balanol is 2-[2,6-dihydroxy-4-[(3R,4R)-3-[(4-hydroxybenzoyl)amino]azepan-4-yl]oxycarbonylbenzoyl]-3-hydroxybenzoic acid.
What is the InChI of balanol?
The InChI of balanol is InChI=1S/C28H26N2O10/c31-16-8-6-14(7-9-16)26(36)30-18-13-29-10-2-5-22(18)40-28(39)15-11-20(33)24(21(34)12-15)25(35)23-17(27(37)38)3-1-4-19(23)32/h1,3-4,6-9,11-12,18,22,29,31-34H,2,5,10,13H2,(H,30,36)(H,37,38)/t18-,22-/m1/s1.
What is the InChIKey of balanol?
The InChIKey of balanol is XYUFCXJZFZPEJD-XMSQKQJNSA-N.
What is the canonical SMILES of balanol?
The canonical SMILES of balanol is C1CC(C(CNC1)NC(=O)C2=CC=C(C=C2)O)OC(=O)C3=CC(=C(C(=C3)O)C(=O)C4=C(C=CC=C4O)C(=O)O).
What is the CAS number of balanol?
The CAS number of balanol is 63590-19-2.
What is the ChEMBL ID of balanol?
The ChEMBL ID of balanol is CHEMBL60254.
What is the Wikipedia page for balanol?
The Wikipedia page for balanol can be found at Balanol.