What is the molecular formula of Astrazon Brilliant Red 4G?
The molecular formula of Astrazon Brilliant Red 4G is C23H26ClN3.
What is the molecular weight of Astrazon Brilliant Red 4G?
The molecular weight of Astrazon Brilliant Red 4G is 379.9 g/mol.
What is the IUPAC name of Astrazon Brilliant Red 4G?
The IUPAC name of Astrazon Brilliant Red 4G is 3-[N-methyl-4-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]anilino]propanenitrile;chloride
What is the InChI of Astrazon Brilliant Red 4G?
The InChI of Astrazon Brilliant Red 4G is InChI=1S/C23H26N3.ClH/c1-23(2)20-8-5-6-9-21(20)26(4)22(23)15-12-18-10-13-19(14-11-18)25(3)17-7-16-24;/h5-6,8-15H,7,17H2,1-4H3;1H/q+1;/p-1
What is the InChIKey of Astrazon Brilliant Red 4G?
The InChIKey of Astrazon Brilliant Red 4G is NJIRSTSECXKPCO-UHFFFAOYSA-M.
What is the canonical SMILES of Astrazon Brilliant Red 4G?
The canonical SMILES of Astrazon Brilliant Red 4G is CC1(C2=CC=CC=C2[N+](=C1C=CC3=CC=C(C=C3)N(C)CCC#N)C)C.[Cl-]
How many hydrogen bond donor counts does Astrazon Brilliant Red 4G have?
Astrazon Brilliant Red 4G has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Astrazon Brilliant Red 4G have?
Astrazon Brilliant Red 4G has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does Astrazon Brilliant Red 4G have?
Astrazon Brilliant Red 4G has 5 rotatable bond counts.
What is the topological polar surface area of Astrazon Brilliant Red 4G?
The topological polar surface area of Astrazon Brilliant Red 4G is 30?2.
What is the CAS number of Astrazon Brilliant Red 4G?
The CAS number of Astrazon Brilliant Red 4G is 12217-48-0.
※ Please kindly note that our products are for research use only.