What is the PubChem CID of Anisodamine?
The PubChem CID of Anisodamine is 6918612.
What is the molecular formula of Anisodamine?
The molecular formula of Anisodamine is C17H23NO4.
What is the molecular weight of Anisodamine?
The molecular weight of Anisodamine is 305.4 g/mol.
What are the synonyms of Anisodamine?
The synonyms of Anisodamine include anisodamine, 55869-99-3, Hyoscyamine, 6-hydroxy-, Anisodamine, (+/-)-, and Raceanisodamine.
What is the IUPAC name of Anisodamine?
The IUPAC name of Anisodamine is [(1R,3S,5R,6S)-6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate.
What is the InChI of Anisodamine?
The InChI of Anisodamine is InChI=1S/C17H23NO4/c1-18-12-7-13(9-15(18)16(20)8-12)22-17(21)14(10-19)11-5-3-2-4-6-11/h2-6,12-16,19-20H,7-10H2,1H3/t12-,13-,14+,15+,16-/m0/s1
What is the InChIKey of Anisodamine?
The InChIKey of Anisodamine is WTQYWNWRJNXDEG-RBZJEDDUSA-N.
What is the canonical SMILES of Anisodamine?
The canonical SMILES of Anisodamine is CN1C2CC(CC1C(C2)O)OC(=O)C(CO)C3=CC=CC=C3.
What is the CAS number of Anisodamine?
The CAS number of Anisodamine is 55869-99-3.
What is the XLogP3 of Anisodamine?
The XLogP3 of Anisodamine is 0.9.